C16H22CrO3 — CID 11102474
[methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium (PubChem CID 11102474) has the molecular formula C16H22CrO3 and a molecular weight of 314.35 g/mol. Its IUPAC name is [methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium.
| Compound Name | [methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium |
|---|---|
| PubChem CID | 11102474 |
| Molecular Formula | C16H22CrO3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [methoxy-[7-[(E)-4-prop-2-enoxybut-2-en-2-yl]-2-oxabicyclo[4.2.0]oct-7-en-8-yl]methylidene]chromium |
| SMILES | C=CCOC/C=C(\C)C1=C(C(=[Cr])OC)C2OCCCC12 |
| InChI | InChI=1S/C16H22O3.Cr/c1-4-8-18-10-7-12(2)15-13-6-5-9-19-16(13)14(15)11-17-3;/h4,7,13,16H,1,5-6,8-10H2,2-3H3;/b12-7+; |
| InChIKey | GAFYUVLNMZLBOT-RRAJOLSVSA-N |
| XLogP | 2.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|