C21H12Cl2N4O2S — CID 11102491
3-benzyl-7-[5-(2,4-dichlorophenyl)furan-2-yl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 11102491) has the molecular formula C21H12Cl2N4O2S and a molecular weight of 455.33 g/mol. Its IUPAC name is 3-benzyl-7-[5-(2,4-dichlorophenyl)furan-2-yl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 3-benzyl-7-[5-(2,4-dichlorophenyl)furan-2-yl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 11102491 |
| Molecular Formula | C21H12Cl2N4O2S |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 3-benzyl-7-[5-(2,4-dichlorophenyl)furan-2-yl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | O=c1c(Cc2ccccc2)nnc2sc(-c3ccc(-c4ccc(Cl)cc4Cl)o3)nn12 |
| InChI | InChI=1S/C21H12Cl2N4O2S/c22-13-6-7-14(15(23)11-13)17-8-9-18(29-17)19-26-27-20(28)16(24-25-21(27)30-19)10-12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | WUBYLHALACBNIB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |