C16H19IN6O2 — CID 111031665
1-(3,4-dimethoxyphenyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111031665) has the molecular formula C16H19IN6O2 and a molecular weight of 454.27 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111031665 |
| Molecular Formula | C16H19IN6O2 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2nnc3ccccn23)cc1OC.I |
| InChI | InChI=1S/C16H18N6O2.HI/c1-23-12-7-6-11(9-13(12)24-2)19-16(17)18-10-15-21-20-14-5-3-4-8-22(14)15;/h3-9H,10H2,1-2H3,(H3,17,18,19);1H |
| InChIKey | NZQICYDEZVJUDN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|