C23H33NO10S — CID 11103274
1-O,1-O-diethyl 3-O-methyl (3S)-3-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propane-1,1,3-tricarboxylate (PubChem CID 11103274) has the molecular formula C23H33NO10S and a molecular weight of 515.58 g/mol. Its IUPAC name is 1-O,1-O-diethyl 3-O-methyl (3S)-3-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propane-1,1,3-tricarboxylate.
| Compound Name | 1-O,1-O-diethyl 3-O-methyl (3S)-3-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 11103274 |
| Molecular Formula | C23H33NO10S |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-O,1-O-diethyl 3-O-methyl (3S)-3-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H33NO10S/c1-8-32-19(25)17(20(26)33-9-2)14-18(21(27)31-7)24(22(28)34-23(4,5)6)35(29,30)16-12-10-15(3)11-13-16/h10-13,17-18H,8-9,14H2,1-7H3/t18-/m0/s1 |
| InChIKey | QZURZJSLLTYTEZ-SFHVURJKSA-N |
| XLogP | 2.59 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|