C18H23NO7S — CID 102487270
ethyl 2-acetyl-3-(2-ethoxy-2-oxoethyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 102487270) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is ethyl 2-acetyl-3-(2-ethoxy-2-oxoethyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | ethyl 2-acetyl-3-(2-ethoxy-2-oxoethyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 102487270 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | ethyl 2-acetyl-3-(2-ethoxy-2-oxoethyl)-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | CCOC(=O)CC1N(S(=O)(=O)c2ccc(C)cc2)C1(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H23NO7S/c1-5-25-16(21)11-15-18(13(4)20,17(22)26-6-2)19(15)27(23,24)14-9-7-12(3)8-10-14/h7-10,15H,5-6,11H2,1-4H3 |
| InChIKey | YIUWNPDCDNNVNC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|