C17H28N4O — CID 111034562
2-[[amino-(2,6-diethylanilino)methylidene]amino]-N-tert-butylacetamide (PubChem CID 111034562) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[[amino-(2,6-diethylanilino)methylidene]amino]-N-tert-butylacetamide.
| Compound Name | 2-[[amino-(2,6-diethylanilino)methylidene]amino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 111034562 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 2-[[amino-(2,6-diethylanilino)methylidene]amino]-N-tert-butylacetamide |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H28N4O/c1-6-12-9-8-10-13(7-2)15(12)20-16(18)19-11-14(22)21-17(3,4)5/h8-10H,6-7,11H2,1-5H3,(H,21,22)(H3,18,19,20) |
| InChIKey | APZHUWBKKWRHIF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|