C18H28N4S — CID 111056157
N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]thiomorpholine-4-carboximidamide (PubChem CID 111056157) has the molecular formula C18H28N4S and a molecular weight of 332.52 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111056157 |
| Molecular Formula | C18H28N4S |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC(C/N=C(\N)N1CCSCC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H28N4S/c1-2-17(13-20-18(19)21-9-11-23-12-10-21)22-8-7-15-5-3-4-6-16(15)14-22/h3-6,17H,2,7-14H2,1H3,(H2,19,20) |
| InChIKey | WLZVUNSNAPANLW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|