C18H28N4 — CID 99853931
1-cyclopropyl-2-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-methylguanidine (PubChem CID 99853931) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-methylguanidine |
|---|---|
| PubChem CID | 99853931 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-cyclopropyl-2-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-methylguanidine |
| SMILES | CC[C@@H](C/N=C(\N)N(C)C1CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H28N4/c1-3-16(12-20-18(19)21(2)17-8-9-17)22-11-10-14-6-4-5-7-15(14)13-22/h4-7,16-17H,3,8-13H2,1-2H3,(H2,19,20)/t16-/m0/s1 |
| InChIKey | SGSWJNJBYATTMT-INIZCTEOSA-N |
| XLogP | 2.23 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|