C13H26N4 — CID 111056802
1-[2-(2-methylpiperidin-1-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111056802) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-[2-(2-methylpiperidin-1-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-[2-(2-methylpiperidin-1-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111056802 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 1-[2-(2-methylpiperidin-1-yl)ethyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCN1CCCCC1C |
| InChI | InChI=1S/C13H26N4/c1-11(2)10-16-13(14)15-7-9-17-8-5-4-6-12(17)3/h12H,1,4-10H2,2-3H3,(H3,14,15,16) |
| InChIKey | QJIVDJSQACLBAH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|