C12H16O3 — CID 11106585
(3R,4S)-4-[(1S)-1-(furan-2-yl)prop-2-enoxy]pent-1-en-3-ol (PubChem CID 11106585) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3R,4S)-4-[(1S)-1-(furan-2-yl)prop-2-enoxy]pent-1-en-3-ol.
| Compound Name | (3R,4S)-4-[(1S)-1-(furan-2-yl)prop-2-enoxy]pent-1-en-3-ol |
|---|---|
| PubChem CID | 11106585 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3R,4S)-4-[(1S)-1-(furan-2-yl)prop-2-enoxy]pent-1-en-3-ol |
| SMILES | C=C[C@H](O[C@@H](C)[C@H](O)C=C)c1ccco1 |
| InChI | InChI=1S/C12H16O3/c1-4-10(13)9(3)15-11(5-2)12-7-6-8-14-12/h4-11,13H,1-2H2,3H3/t9-,10+,11-/m0/s1 |
| InChIKey | UNFYEVKVKVJKSJ-AXFHLTTASA-N |
| XLogP | 2.46 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|