C14H28F3N5O — CID 111066479
2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111066479) has the molecular formula C14H28F3N5O and a molecular weight of 339.41 g/mol. Its IUPAC name is 2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111066479 |
| Molecular Formula | C14H28F3N5O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | CN(CCC/N=C(\N)NCCCN1CCOCC1)CC(F)(F)F |
| InChI | InChI=1S/C14H28F3N5O/c1-21(12-14(15,16)17)6-2-4-19-13(18)20-5-3-7-22-8-10-23-11-9-22/h2-12H2,1H3,(H3,18,19,20) |
| InChIKey | KFFXENLLORVCKG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|