C16H27IN4O3 — CID 111068201
3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111068201) has the molecular formula C16H27IN4O3 and a molecular weight of 450.32 g/mol. Its IUPAC name is 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111068201 |
| Molecular Formula | C16H27IN4O3 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 3-[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/CCC(=O)N(C)C)cc1OC.I |
| InChI | InChI=1S/C16H26N4O3.HI/c1-20(2)15(21)8-10-19-16(17)18-9-7-12-5-6-13(22-3)14(11-12)23-4;/h5-6,11H,7-10H2,1-4H3,(H3,17,18,19);1H |
| InChIKey | NVYPKJHSJXBVPH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|