C10H12N2O3S — CID 11107463
N-methyl-1,1-dioxo-N-phenylthiazetidine-2-carboxamide (PubChem CID 11107463) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-phenylthiazetidine-2-carboxamide.
| Compound Name | N-methyl-1,1-dioxo-N-phenylthiazetidine-2-carboxamide |
|---|---|
| PubChem CID | 11107463 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | N-methyl-1,1-dioxo-N-phenylthiazetidine-2-carboxamide |
| SMILES | CN(C(=O)N1CCS1(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O3S/c1-11(9-5-3-2-4-6-9)10(13)12-7-8-16(12,14)15/h2-6H,7-8H2,1H3 |
| InChIKey | AGPLKWMLDJGGML-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |