C21H31IN4O4S — CID 111079892
2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111079892) has the molecular formula C21H31IN4O4S and a molecular weight of 562.47 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111079892 |
| Molecular Formula | C21H31IN4O4S |
| Molecular Weight | 562.47 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCc2ccc(S(=O)(=O)N(C)C(C)C)cc2)cc1OC.I |
| InChI | InChI=1S/C21H30N4O4S.HI/c1-15(2)25(3)30(26,27)18-9-6-16(7-10-18)13-23-21(22)24-14-17-8-11-19(28-4)20(12-17)29-5;/h6-12,15H,13-14H2,1-5H3,(H3,22,23,24);1H |
| InChIKey | LCYWBWZBDAIMFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|