C21H27FIN3O3 — CID 111080572
1-(2,5-dimethoxyphenyl)-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111080572) has the molecular formula C21H27FIN3O3 and a molecular weight of 515.37 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111080572 |
| Molecular Formula | C21H27FIN3O3 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[[4-(4-fluorophenyl)oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(N/C(N)=N/CC2(c3ccc(F)cc3)CCOCC2)c1.I |
| InChI | InChI=1S/C21H26FN3O3.HI/c1-26-17-7-8-19(27-2)18(13-17)25-20(23)24-14-21(9-11-28-12-10-21)15-3-5-16(22)6-4-15;/h3-8,13H,9-12,14H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | LNGHNDVDZZOMNI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|