C18H26O3 — CID 11109049
(1R,2S,7S,9S,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-5-en-11-one (PubChem CID 11109049) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1R,2S,7S,9S,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-5-en-11-one.
| Compound Name | (1R,2S,7S,9S,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-5-en-11-one |
|---|---|
| PubChem CID | 11109049 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1R,2S,7S,9S,10S,12S,14S)-9-hydroxy-2,6,10,12-tetramethyl-13-oxatetracyclo[8.5.0.02,7.012,14]pentadec-5-en-11-one |
| SMILES | CC1=CCC[C@]2(C)[C@H]3C[C@@H]4O[C@]4(C)C(=O)[C@]3(C)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C18H26O3/c1-10-6-5-7-16(2)11(10)8-13(19)17(3)12(16)9-14-18(4,21-14)15(17)20/h6,11-14,19H,5,7-9H2,1-4H3/t11-,12+,13-,14-,16-,17-,18-/m0/s1 |
| InChIKey | HGDQNISHNSZISW-YMGSHYCDSA-N |
| XLogP | 2.87 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|