C21H30O4 — CID 163091034
(1S,2R,3R,4R,7R,9R,17R)-3,4-dihydroxy-2,6,6,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-12,14-dien-11-one (PubChem CID 163091034) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S,2R,3R,4R,7R,9R,17R)-3,4-dihydroxy-2,6,6,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-12,14-dien-11-one.
| Compound Name | (1S,2R,3R,4R,7R,9R,17R)-3,4-dihydroxy-2,6,6,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-12,14-dien-11-one |
|---|---|
| PubChem CID | 163091034 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1S,2R,3R,4R,7R,9R,17R)-3,4-dihydroxy-2,6,6,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-12,14-dien-11-one |
| SMILES | CC1=CC[C@@H]2[C@]3(C)C1=CC(=O)O[C@@H]3C[C@@H]1C(C)(C)C[C@@H](O)[C@H](O)[C@]12C |
| InChI | InChI=1S/C21H30O4/c1-11-6-7-14-20(4)12(11)8-17(23)25-16(20)9-15-19(2,3)10-13(22)18(24)21(14,15)5/h6,8,13-16,18,22,24H,7,9-10H2,1-5H3/t13-,14-,15-,16-,18+,20+,21+/m1/s1 |
| InChIKey | CPBRPGCWCFQZEJ-RZGVZEAFSA-N |
| XLogP | 2.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |