C23H30FN7O — CID 111100645
1-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 111100645) has the molecular formula C23H30FN7O and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111100645 |
| Molecular Formula | C23H30FN7O |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(c2ncccc2C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C23H30FN7O/c24-19-5-7-20(8-6-19)29-11-13-30(14-12-29)23(26)28-15-17-3-1-9-27-22(17)31-10-2-4-18(16-31)21(25)32/h1,3,5-9,18H,2,4,10-16H2,(H2,25,32)(H2,26,28) |
| InChIKey | YKWKEIZFZVLTGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|