C18H19NO7 — CID 11111201
3-O-benzyl 4-O-methyl (1S,2R,4S,6S,7R)-6-hydroxy-8,9-dioxa-3-azatricyclo[5.2.2.02,6]undec-10-ene-3,4-dicarboxylate (PubChem CID 11111201) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is 3-O-benzyl 4-O-methyl (1S,2R,4S,6S,7R)-6-hydroxy-8,9-dioxa-3-azatricyclo[5.2.2.02,6]undec-10-ene-3,4-dicarboxylate.
| Compound Name | 3-O-benzyl 4-O-methyl (1S,2R,4S,6S,7R)-6-hydroxy-8,9-dioxa-3-azatricyclo[5.2.2.02,6]undec-10-ene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11111201 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-O-benzyl 4-O-methyl (1S,2R,4S,6S,7R)-6-hydroxy-8,9-dioxa-3-azatricyclo[5.2.2.02,6]undec-10-ene-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@]2(O)[C@H]3C=C[C@H](OO3)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO7/c1-23-16(20)12-9-18(22)14-8-7-13(25-26-14)15(18)19(12)17(21)24-10-11-5-3-2-4-6-11/h2-8,12-15,22H,9-10H2,1H3/t12-,13-,14+,15+,18+/m0/s1 |
| InChIKey | QSXRGTVGERDMBF-PQHDGLIZSA-N |
| XLogP | 0.94 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|