About chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid
chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 11111797) has the molecular formula C15H23ClNO2Ru
and a molecular weight of 385.88 g/mol. Its IUPAC name is chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 11111797 |
| Molecular Formula | C15H23ClNO2Ru |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(C(C)C)cc1.Cl[Ru].O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H14.C5H9NO2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;7-5(8)4-2-1-3-6-4;;/h4-8H,1-3H3;4,6H,1-3H2,(H,7,8);1H;/q;;;+1/p-1/t;4-;;/m.0../s1 |
| InChIKey | IBXDOPIRDXCHCT-HWBXBCIZSA-M |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid (CID 11111797) is chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid is Cc1ccc(C(C)C)cc1.Cl[Ru].O=C(O)[C@@H]1CCCN1.
What is the InChIKey of chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is IBXDOPIRDXCHCT-HWBXBCIZSA-M. The full InChI is InChI=1S/C10H14.C5H9NO2.ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;7-5(8)4-2-1-3-6-4;;/h4-8H,1-3H3;4,6H,1-3H2,(H,7,8);1H;/q;;;+1/p-1/t;4-;;/m.0../s1.
What are the key properties of chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid?
chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 385.88 g/mol, XLogP of 3.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlororuthenium;1-methyl-4-propan-2-ylbenzene;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 11111797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).