C18H22ClNO3 — CID 111121700
1-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-2-phenylpropan-2-ol (PubChem CID 111121700) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 1-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-2-phenylpropan-2-ol.
| Compound Name | 1-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 111121700 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[(3-chloro-4,5-dimethoxyphenyl)methylamino]-2-phenylpropan-2-ol |
| SMILES | COc1cc(CNCC(C)(O)c2ccccc2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H22ClNO3/c1-18(21,14-7-5-4-6-8-14)12-20-11-13-9-15(19)17(23-3)16(10-13)22-2/h4-10,20-21H,11-12H2,1-3H3 |
| InChIKey | NXSMGUDDEYMPIJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |