C23H33N3O4 — CID 11112471
tert-butyl N-[(E)-C-(3,4-dihydro-2H-quinolin-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-prop-2-enylcarbamate (PubChem CID 11112471) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl N-[(E)-C-(3,4-dihydro-2H-quinolin-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(E)-C-(3,4-dihydro-2H-quinolin-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 11112471 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | tert-butyl N-[(E)-C-(3,4-dihydro-2H-quinolin-1-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbonimidoyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)/C(=N/C(=O)OC(C)(C)C)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H33N3O4/c1-8-15-26(21(28)30-23(5,6)7)19(24-20(27)29-22(2,3)4)25-16-11-13-17-12-9-10-14-18(17)25/h8-10,12,14H,1,11,13,15-16H2,2-7H3/b24-19+ |
| InChIKey | PGHWSVPUVMLDOR-LYBHJNIJSA-N |
| XLogP | 5.15 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|