C21H40O6Si — CID 11112508
4-O-tert-butyl 1-O-ethyl (Z)-3-[(1R)-1-[diethyl(propan-2-yl)silyl]oxy-3-hydroxypropyl]-2-methylbut-2-enedioate (PubChem CID 11112508) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl (Z)-3-[(1R)-1-[diethyl(propan-2-yl)silyl]oxy-3-hydroxypropyl]-2-methylbut-2-enedioate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl (Z)-3-[(1R)-1-[diethyl(propan-2-yl)silyl]oxy-3-hydroxypropyl]-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 11112508 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl (Z)-3-[(1R)-1-[diethyl(propan-2-yl)silyl]oxy-3-hydroxypropyl]-2-methylbut-2-enedioate |
| SMILES | CCOC(=O)/C(C)=C(\C(=O)OC(C)(C)C)[C@@H](CCO)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C21H40O6Si/c1-10-25-19(23)16(6)18(20(24)26-21(7,8)9)17(13-14-22)27-28(11-2,12-3)15(4)5/h15,17,22H,10-14H2,1-9H3/b18-16-/t17-/m1/s1 |
| InChIKey | FXFBGINNYJGHIV-FXBHHXAOSA-N |
| XLogP | 4.37 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|