C21H29IN4O3S — CID 111141022
2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111141022) has the molecular formula C21H29IN4O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141022 |
| Molecular Formula | C21H29IN4O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(Oc2ccc(C)c(C)c2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C21H28N4O3S.HI/c1-4-22-21(25-18-8-10-29(26,27)14-18)24-13-17-7-9-23-20(12-17)28-19-6-5-15(2)16(3)11-19;/h5-7,9,11-12,18H,4,8,10,13-14H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | WYKYJFFPMJDYLZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|