C21H32N6O3 — CID 111146188
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine (PubChem CID 111146188) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111146188 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3,4,5-trimethoxyphenyl)guanidine |
| SMILES | COc1cc(N/C(=N/Cc2nnc(C)n2C)NC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H32N6O3/c1-14-25-26-19(27(14)2)13-22-21(23-15-9-7-6-8-10-15)24-16-11-17(28-3)20(30-5)18(12-16)29-4/h11-12,15H,6-10,13H2,1-5H3,(H2,22,23,24) |
| InChIKey | GKNYNCHTSTVPFC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|