C19H31N5O3S — CID 111147357
1-[2-(benzylsulfamoyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111147357) has the molecular formula C19H31N5O3S and a molecular weight of 409.56 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111147357 |
| Molecular Formula | C19H31N5O3S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H31N5O3S/c1-2-20-19(21-11-7-14-24-13-6-10-18(24)25)22-12-15-28(26,27)23-16-17-8-4-3-5-9-17/h3-5,8-9,23H,2,6-7,10-16H2,1H3,(H2,20,21,22) |
| InChIKey | BYRMAJYTIUVOGZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|