C24H41N5 — CID 111152764
4-benzyl-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperidine-1-carboximidamide (PubChem CID 111152764) has the molecular formula C24H41N5 and a molecular weight of 399.63 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzyl-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111152764 |
| Molecular Formula | C24H41N5 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.34 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-[2-(4-ethylpiperazin-1-yl)propyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)N1CCN(CC)CC1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H41N5/c1-4-25-24(26-20-21(3)28-17-15-27(5-2)16-18-28)29-13-11-23(12-14-29)19-22-9-7-6-8-10-22/h6-10,21,23H,4-5,11-20H2,1-3H3,(H,25,26) |
| InChIKey | PTXPNDBNPVHZCU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|