C20H36 — CID 11119363
cis-(1S,2R)-1-decyl-2-hept-6-ynylcyclopropane (PubChem CID 11119363) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is cis-(1S,2R)-1-decyl-2-hept-6-ynylcyclopropane.
| Compound Name | cis-(1S,2R)-1-decyl-2-hept-6-ynylcyclopropane |
|---|---|
| PubChem CID | 11119363 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | cis-(1S,2R)-1-decyl-2-hept-6-ynylcyclopropane |
| SMILES | C#CCCCCC[C@@H]1C[C@@H]1CCCCCCCCCC |
| InChI | InChI=1S/C20H36/c1-3-5-7-9-10-11-13-15-17-20-18-19(20)16-14-12-8-6-4-2/h2,19-20H,3,5-18H2,1H3/t19-,20+/m1/s1 |
| InChIKey | RNBLORUTBHCPEA-UXHICEINSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|