C18H34O2Si — CID 11120484
(3R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethylnon-1-yn-4-one (PubChem CID 11120484) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (3R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethylnon-1-yn-4-one.
| Compound Name | (3R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethylnon-1-yn-4-one |
|---|---|
| PubChem CID | 11120484 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethylnon-1-yn-4-one |
| SMILES | C#C[C@@H](C)C(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C18H34O2Si/c1-11-13(3)16(19)15(5)17(14(4)12-2)20-21(9,10)18(6,7)8/h1,13-15,17H,12H2,2-10H3/t13-,14+,15-,17+/m1/s1 |
| InChIKey | ZJLVFZMXFLZRHN-DLTWYDFYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|