C14H18N2O5S — CID 11120946
dimethyl 2-(4-cyano-5-morpholin-4-yl-2,3-dihydrothiophen-1-ylidene)propanedioate (PubChem CID 11120946) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is dimethyl 2-(4-cyano-5-morpholin-4-yl-2,3-dihydrothiophen-1-ylidene)propanedioate.
| Compound Name | dimethyl 2-(4-cyano-5-morpholin-4-yl-2,3-dihydrothiophen-1-ylidene)propanedioate |
|---|---|
| PubChem CID | 11120946 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | dimethyl 2-(4-cyano-5-morpholin-4-yl-2,3-dihydrothiophen-1-ylidene)propanedioate |
| SMILES | COC(=O)C(C(=O)OC)=S1CCC(C#N)=C1N1CCOCC1 |
| InChI | InChI=1S/C14H18N2O5S/c1-19-13(17)11(14(18)20-2)22-8-3-10(9-15)12(22)16-4-6-21-7-5-16/h3-8H2,1-2H3 |
| InChIKey | ZEQGITZOMCMXBX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|