C22H26N2O5S — CID 11750786
diethyl 2-(4-cyano-5-morpholin-4-yl-3-phenyl-2,3-dihydrothiophen-1-ylidene)propanedioate (PubChem CID 11750786) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is diethyl 2-(4-cyano-5-morpholin-4-yl-3-phenyl-2,3-dihydrothiophen-1-ylidene)propanedioate.
| Compound Name | diethyl 2-(4-cyano-5-morpholin-4-yl-3-phenyl-2,3-dihydrothiophen-1-ylidene)propanedioate |
|---|---|
| PubChem CID | 11750786 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | diethyl 2-(4-cyano-5-morpholin-4-yl-3-phenyl-2,3-dihydrothiophen-1-ylidene)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)=S1CC(c2ccccc2)C(C#N)=C1N1CCOCC1 |
| InChI | InChI=1S/C22H26N2O5S/c1-3-28-21(25)19(22(26)29-4-2)30-15-18(16-8-6-5-7-9-16)17(14-23)20(30)24-10-12-27-13-11-24/h5-9,18H,3-4,10-13,15H2,1-2H3 |
| InChIKey | HRXFBFQBPCIDDC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|