C18H34O3Si — CID 11120961
trans-methyl (1R,2R)-2-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate (PubChem CID 11120961) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-2-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11120961 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | trans-methyl (1R,2R)-2-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylate |
| SMILES | C=CCC[C@]1(O[Si](C)(C)C(C)(C)C)CCCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H34O3Si/c1-8-9-13-18(21-22(6,7)17(2,3)4)14-11-10-12-15(18)16(19)20-5/h8,15H,1,9-14H2,2-7H3/t15-,18-/m0/s1 |
| InChIKey | OZDZQYHNXUJQSA-YJBOKZPZSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|