C17H32O3Si — CID 11066952
trans-(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylic acid (PubChem CID 11066952) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is trans-(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11066952 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | trans-(1R,3R)-3-but-3-enyl-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carboxylic acid |
| SMILES | C=CCC[C@H]1CCC[C@@H](C(=O)O)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-7-8-10-13-11-9-12-14(16(18)19)15(13)20-21(5,6)17(2,3)4/h7,13-15H,1,8-12H2,2-6H3,(H,18,19)/t13-,14+,15?/m0/s1 |
| InChIKey | NAJIHOWNWCTBQC-SNTRVMSOSA-N |
| XLogP | 4.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|