C19H36O3Si — CID 46894845
ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]acetate (PubChem CID 46894845) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]acetate.
| Compound Name | ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]acetate |
|---|---|
| PubChem CID | 46894845 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]acetate |
| SMILES | C=CC[C@H]1CCCC[C@@]1(CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-8-12-16-13-10-11-14-19(16,15-17(20)21-9-2)22-23(6,7)18(3,4)5/h8,16H,1,9-15H2,2-7H3/t16-,19-/m0/s1 |
| InChIKey | QEJOVPTYWBCNII-LPHOPBHVSA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|