C21H40O3Si — CID 46894947
ethyl 2-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]-2-methylpropanoate (PubChem CID 46894947) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is ethyl 2-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 46894947 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | ethyl 2-[(1R,2R)-1-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclohexyl]-2-methylpropanoate |
| SMILES | C=CC[C@H]1CCCC[C@]1(O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C21H40O3Si/c1-10-14-17-15-12-13-16-21(17,20(6,7)18(22)23-11-2)24-25(8,9)19(3,4)5/h10,17H,1,11-16H2,2-9H3/t17-,21+/m0/s1 |
| InChIKey | IIDZYHOKIOFQSU-LAUBAEHRSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|