C18H36O3Si — CID 11551629
ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-7-enoate (PubChem CID 11551629) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-7-enoate.
| Compound Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-7-enoate |
|---|---|
| PubChem CID | 11551629 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-7-enoate |
| SMILES | C=CCCC[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C18H36O3Si/c1-10-12-13-14-15(18(6,7)16(19)20-11-2)21-22(8,9)17(3,4)5/h10,15H,1,11-14H2,2-9H3/t15-/m1/s1 |
| InChIKey | GBMXYKPYEOZPFZ-OAHLLOKOSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|