C22H28FN5O2 — CID 111219243
N-ethyl-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219243) has the molecular formula C22H28FN5O2 and a molecular weight of 413.50 g/mol. Its IUPAC name is N-ethyl-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219243 |
| Molecular Formula | C22H28FN5O2 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-ethyl-N'-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cc(F)cc2c1OCOC2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H28FN5O2/c1-2-24-22(28-11-9-27(10-12-28)20-5-3-4-7-25-20)26-8-6-17-13-19(23)14-18-15-29-16-30-21(17)18/h3-5,7,13-14H,2,6,8-12,15-16H2,1H3,(H,24,26) |
| InChIKey | JNYDGIFQWMIEAV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|