C21H27N5O3 — CID 111219399
N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide (PubChem CID 111219399) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111219399 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yloxy)ethyl]-N-ethyl-4-pyridin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCOc1ccc2c(c1)OCO2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-2-22-21(26-12-10-25(11-13-26)20-5-3-4-8-23-20)24-9-14-27-17-6-7-18-19(15-17)29-16-28-18/h3-8,15H,2,9-14,16H2,1H3,(H,22,24) |
| InChIKey | NAKWNAMPMUTZQR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|