C31H26N2O5 — CID 11124010
1-[(1R)-1-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]but-3-yn-2-yl]oxyprop-2-ynyl]pyrimidine-2,4-dione (PubChem CID 11124010) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 1-[(1R)-1-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]but-3-yn-2-yl]oxyprop-2-ynyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-1-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]but-3-yn-2-yl]oxyprop-2-ynyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11124010 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 1-[(1R)-1-[(2S)-1-[(4-methoxyphenyl)-diphenylmethoxy]but-3-yn-2-yl]oxyprop-2-ynyl]pyrimidine-2,4-dione |
| SMILES | C#C[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccc(OC)cc1)O[C@H](C#C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C31H26N2O5/c1-4-26(38-29(5-2)33-21-20-28(34)32-30(33)35)22-37-31(23-12-8-6-9-13-23,24-14-10-7-11-15-24)25-16-18-27(36-3)19-17-25/h1-2,6-21,26,29H,22H2,3H3,(H,32,34,35)/t26-,29+/m0/s1 |
| InChIKey | ULBRUKMFPBHMPY-LITSAYRRSA-N |
| XLogP | 3.70 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|