C32H40O14S2 — CID 11125399
[(9S,10R)-9,10-dihydroxy-3,4,5,14,16-pentamethoxy-10-(methylsulfonyloxymethyl)-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl]methyl methanesulfonate (PubChem CID 11125399) has the molecular formula C32H40O14S2 and a molecular weight of 712.79 g/mol. Its IUPAC name is [(9S,10R)-9,10-dihydroxy-3,4,5,14,16-pentamethoxy-10-(methylsulfonyloxymethyl)-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl]methyl methanesulfonate.
| Compound Name | [(9S,10R)-9,10-dihydroxy-3,4,5,14,16-pentamethoxy-10-(methylsulfonyloxymethyl)-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11125399 |
| Molecular Formula | C32H40O14S2 |
| Molecular Weight | 712.79 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | [(9S,10R)-9,10-dihydroxy-3,4,5,14,16-pentamethoxy-10-(methylsulfonyloxymethyl)-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaenyl]methyl methanesulfonate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OCc3ccccc3)c1OC)C[C@@](O)(COS(C)(=O)=O)[C@@](O)(COS(C)(=O)=O)C2 |
| InChI | InChI=1S/C32H40O14S2/c1-39-23-13-21-15-31(33,18-45-47(6,35)36)32(34,19-46-48(7,37)38)16-22-14-24(40-2)28(44-17-20-11-9-8-10-12-20)30(43-5)26(22)25(21)29(42-4)27(23)41-3/h8-14,33-34H,15-19H2,1-7H3/t31-,32+/m0/s1 |
| InChIKey | DNHIEXFBZUJPNF-AJQTZOPKSA-N |
| XLogP | 2.49 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|