C30H34O8 — CID 11135117
[(9Z)-10-(hydroxymethyl)-3,4,5,14,16-pentamethoxy-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,9,12,14-heptaenyl]methanol (PubChem CID 11135117) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is [(9Z)-10-(hydroxymethyl)-3,4,5,14,16-pentamethoxy-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,9,12,14-heptaenyl]methanol.
| Compound Name | [(9Z)-10-(hydroxymethyl)-3,4,5,14,16-pentamethoxy-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,9,12,14-heptaenyl]methanol |
|---|---|
| PubChem CID | 11135117 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [(9Z)-10-(hydroxymethyl)-3,4,5,14,16-pentamethoxy-15-phenylmethoxy-9-tricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,9,12,14-heptaenyl]methanol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc(OC)c(OCc3ccccc3)c1OC)C/C(CO)=C(/CO)C2 |
| InChI | InChI=1S/C30H34O8/c1-33-23-13-19-11-21(15-31)22(16-32)12-20-14-24(34-2)28(38-17-18-9-7-6-8-10-18)30(37-5)26(20)25(19)29(36-4)27(23)35-3/h6-10,13-14,31-32H,11-12,15-17H2,1-5H3/b22-21- |
| InChIKey | WIPQUESFWFXDFP-DQRAZIAOSA-N |
| XLogP | 4.36 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|