C44H42NaO14S2+ — CID 54600730
sodium [3-methoxy-2-[2-methoxy-3,4-bis(phenylmethoxy)-6-(sulfooxymethyl)phenyl]-4,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate (PubChem CID 54600730) has the molecular formula C44H42NaO14S2+ and a molecular weight of 881.93 g/mol. Its IUPAC name is sodium [3-methoxy-2-[2-methoxy-3,4-bis(phenylmethoxy)-6-(sulfooxymethyl)phenyl]-4,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate.
| Compound Name | sodium [3-methoxy-2-[2-methoxy-3,4-bis(phenylmethoxy)-6-(sulfooxymethyl)phenyl]-4,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 54600730 |
| Molecular Formula | C44H42NaO14S2+ |
| Molecular Weight | 881.93 g/mol |
| Exact Mass | 881.19 |
| IUPAC Name | sodium [3-methoxy-2-[2-methoxy-3,4-bis(phenylmethoxy)-6-(sulfooxymethyl)phenyl]-4,5-bis(phenylmethoxy)phenyl]methyl hydrogen sulfate |
| SMILES | COc1c(OCc2ccccc2)c(OCc2ccccc2)cc(COS(=O)(=O)O)c1-c1c(COS(=O)(=O)O)cc(OCc2ccccc2)c(OCc2ccccc2)c1OC.[Na+] |
| InChI | InChI=1S/C44H42O14S2.Na/c1-51-43-39(35(29-57-59(45,46)47)23-37(53-25-31-15-7-3-8-16-31)41(43)55-27-33-19-11-5-12-20-33)40-36(30-58-60(48,49)50)24-38(54-26-32-17-9-4-10-18-32)42(44(40)52-2)56-28-34-21-13-6-14-22-34;/h3-24H,25-30H2,1-2H3,(H,45,46,47)(H,48,49,50);/q;+1 |
| InChIKey | FBGHVFQLDBEGNR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|