C8H8N2O — CID 11126423
imidazo[1,2-a]pyridin-5-ylmethanol (PubChem CID 11126423) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-5-ylmethanol.
| Compound Name | imidazo[1,2-a]pyridin-5-ylmethanol |
|---|---|
| PubChem CID | 11126423 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | imidazo[1,2-a]pyridin-5-ylmethanol |
| SMILES | OCc1cccc2nccn12 |
| InChI | InChI=1S/C8H8N2O/c11-6-7-2-1-3-8-9-4-5-10(7)8/h1-5,11H,6H2 |
| InChIKey | HTTSIZUFZZFCTK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |