C19H27IN4O3S — CID 111271440
3-[[2-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111271440) has the molecular formula C19H27IN4O3S and a molecular weight of 518.42 g/mol. Its IUPAC name is 3-[[2-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[2-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111271440 |
| Molecular Formula | C19H27IN4O3S |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 3-[[2-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1NS(C)(=O)=O)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C19H26N4O3S.HI/c1-20-19(23(2)14-15-9-11-17(26-3)12-10-15)21-13-16-7-5-6-8-18(16)22-27(4,24)25;/h5-12,22H,13-14H2,1-4H3,(H,20,21);1H |
| InChIKey | SOISLVAQMUERCW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|