C21H30N4O3S — CID 111274721
3-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111274721) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 3-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111274721 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | CCOc1ccc(CN(C)/C(=N\C)NCc2ccccc2S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H30N4O3S/c1-6-28-19-13-11-17(12-14-19)16-25(5)21(22-2)23-15-18-9-7-8-10-20(18)29(26,27)24(3)4/h7-14H,6,15-16H2,1-5H3,(H,22,23) |
| InChIKey | ZWMZIYXZAUGIIH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|