About ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate
ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate (PubChem CID 11127798) has the molecular formula C13H13FO2
and a molecular weight of 220.24 g/mol. Its IUPAC name is ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate |
| PubChem CID | 11127798 |
| Molecular Formula | C13H13FO2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=Cc2ccc(F)cc21 |
| InChI | InChI=1S/C13H13FO2/c1-2-16-13(15)11-5-3-4-9-6-7-10(14)8-12(9)11/h3-4,6-8,11H,2,5H2,1H3 |
| InChIKey | RBWMQDJZHKQQHA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate?
The IUPAC name of ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate (CID 11127798) is ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate.
What is the SMILES notation for ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate?
The canonical SMILES for ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate is CCOC(=O)C1CC=Cc2ccc(F)cc21.
What is the InChIKey of ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate?
The InChIKey is RBWMQDJZHKQQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FO2/c1-2-16-13(15)11-5-3-4-9-6-7-10(14)8-12(9)11/h3-4,6-8,11H,2,5H2,1H3.
What are the key properties of ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate?
ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate has a molecular weight of 220.24 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-fluoro-1,2-dihydronaphthalene-1-carboxylate is sourced from PubChem (CID 11127798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).