C10H9FO — CID 130149519
7-fluoro-1,2-dihydronaphthalen-1-ol (PubChem CID 130149519) has the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. Its IUPAC name is 7-fluoro-1,2-dihydronaphthalen-1-ol.
| Compound Name | 7-fluoro-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 130149519 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 7-fluoro-1,2-dihydronaphthalen-1-ol |
| SMILES | OC1CC=Cc2ccc(F)cc21 |
| InChI | InChI=1S/C10H9FO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h1-2,4-6,10,12H,3H2 |
| InChIKey | HRHLSAMVNVOIGV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |