About 4-(2,5-difluorophenyl)cyclohexan-1-ol
4-(2,5-difluorophenyl)cyclohexan-1-ol (PubChem CID 116963227) has the molecular formula C12H14F2O
and a molecular weight of 212.24 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(2,5-difluorophenyl)cyclohexan-1-ol |
| PubChem CID | 116963227 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-(2,5-difluorophenyl)cyclohexan-1-ol |
| SMILES | OC1CCC(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C12H14F2O/c13-9-3-6-12(14)11(7-9)8-1-4-10(15)5-2-8/h3,6-8,10,15H,1-2,4-5H2 |
| InChIKey | GLPJQENQXSXLRJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,5-difluorophenyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-difluorophenyl)cyclohexan-1-ol?
The IUPAC name of 4-(2,5-difluorophenyl)cyclohexan-1-ol (CID 116963227) is 4-(2,5-difluorophenyl)cyclohexan-1-ol.
What is the SMILES notation for 4-(2,5-difluorophenyl)cyclohexan-1-ol?
The canonical SMILES for 4-(2,5-difluorophenyl)cyclohexan-1-ol is OC1CCC(c2cc(F)ccc2F)CC1.
What is the InChIKey of 4-(2,5-difluorophenyl)cyclohexan-1-ol?
The InChIKey is GLPJQENQXSXLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O/c13-9-3-6-12(14)11(7-9)8-1-4-10(15)5-2-8/h3,6-8,10,15H,1-2,4-5H2.
What are the key properties of 4-(2,5-difluorophenyl)cyclohexan-1-ol?
4-(2,5-difluorophenyl)cyclohexan-1-ol has a molecular weight of 212.24 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluorophenyl)cyclohexan-1-ol is sourced from PubChem (CID 116963227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).