C11H12F2N2S — CID 134367809
3-(2,5-difluorophenyl)pyrrolidine-1-carbothioamide (PubChem CID 134367809) has the molecular formula C11H12F2N2S and a molecular weight of 242.29 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)pyrrolidine-1-carbothioamide.
| Compound Name | 3-(2,5-difluorophenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134367809 |
| Molecular Formula | C11H12F2N2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-(2,5-difluorophenyl)pyrrolidine-1-carbothioamide |
| SMILES | NC(=S)N1CCC(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C11H12F2N2S/c12-8-1-2-10(13)9(5-8)7-3-4-15(6-7)11(14)16/h1-2,5,7H,3-4,6H2,(H2,14,16) |
| InChIKey | QQVNJLHTIFEEIF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|