C11H11F3N2S — CID 134368266
(3S)-3-(2,4,5-trifluorophenyl)pyrrolidine-1-carbothioamide (PubChem CID 134368266) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is (3S)-3-(2,4,5-trifluorophenyl)pyrrolidine-1-carbothioamide.
| Compound Name | (3S)-3-(2,4,5-trifluorophenyl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134368266 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (3S)-3-(2,4,5-trifluorophenyl)pyrrolidine-1-carbothioamide |
| SMILES | NC(=S)N1CC[C@@H](c2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C11H11F3N2S/c12-8-4-10(14)9(13)3-7(8)6-1-2-16(5-6)11(15)17/h3-4,6H,1-2,5H2,(H2,15,17)/t6-/m1/s1 |
| InChIKey | AKGOTNIHZWSLST-ZCFIWIBFSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|